C15H18BrClN4O — CID 119634681
[2-(aminomethyl)pyrrolidin-1-yl]-[1-(3-bromophenyl)pyrazol-3-yl]methanone;hydrochloride (PubChem CID 119634681) has the molecular formula C15H18BrClN4O and a molecular weight of 385.69 g/mol. Its IUPAC name is [2-(aminomethyl)pyrrolidin-1-yl]-[1-(3-bromophenyl)pyrazol-3-yl]methanone;hydrochloride.
| Compound Name | [2-(aminomethyl)pyrrolidin-1-yl]-[1-(3-bromophenyl)pyrazol-3-yl]methanone;hydrochloride |
|---|---|
| PubChem CID | 119634681 |
| Molecular Formula | C15H18BrClN4O |
| Molecular Weight | 385.69 g/mol |
| Exact Mass | 384.04 |
| IUPAC Name | [2-(aminomethyl)pyrrolidin-1-yl]-[1-(3-bromophenyl)pyrazol-3-yl]methanone;hydrochloride |
| SMILES | Cl.NCC1CCCN1C(=O)c1ccn(-c2cccc(Br)c2)n1 |
| InChI | InChI=1S/C15H17BrN4O.ClH/c16-11-3-1-4-12(9-11)20-8-6-14(18-20)15(21)19-7-2-5-13(19)10-17;/h1,3-4,6,8-9,13H,2,5,7,10,17H2;1H |
| InChIKey | PRWQYONIJQDUCU-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 64.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.69 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |