C15H18N4O — CID 119634575
[2-(aminomethyl)pyrrolidin-1-yl]-(1-phenylpyrazol-3-yl)methanone (PubChem CID 119634575) has the molecular formula C15H18N4O and a molecular weight of 270.34 g/mol. Its IUPAC name is [2-(aminomethyl)pyrrolidin-1-yl]-(1-phenylpyrazol-3-yl)methanone.
| Compound Name | [2-(aminomethyl)pyrrolidin-1-yl]-(1-phenylpyrazol-3-yl)methanone |
|---|---|
| PubChem CID | 119634575 |
| Molecular Formula | C15H18N4O |
| Molecular Weight | 270.34 g/mol |
| Exact Mass | 270.15 |
| IUPAC Name | [2-(aminomethyl)pyrrolidin-1-yl]-(1-phenylpyrazol-3-yl)methanone |
| SMILES | NCC1CCCN1C(=O)c1ccn(-c2ccccc2)n1 |
| InChI | InChI=1S/C15H18N4O/c16-11-13-7-4-9-18(13)15(20)14-8-10-19(17-14)12-5-2-1-3-6-12/h1-3,5-6,8,10,13H,4,7,9,11,16H2 |
| InChIKey | NLKPEEFVMLNNIP-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 64.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.34 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |