C16H23N3O4 — CID 119469336
2-[2-[2-(aminomethyl)piperidin-1-yl]-2-oxoethyl]-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindole-1,3-dione (PubChem CID 119469336) has the molecular formula C16H23N3O4 and a molecular weight of 321.38 g/mol. Its IUPAC name is 2-[2-[2-(aminomethyl)piperidin-1-yl]-2-oxoethyl]-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindole-1,3-dione.
| Compound Name | 2-[2-[2-(aminomethyl)piperidin-1-yl]-2-oxoethyl]-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindole-1,3-dione |
|---|---|
| PubChem CID | 119469336 |
| Molecular Formula | C16H23N3O4 |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.17 |
| IUPAC Name | 2-[2-[2-(aminomethyl)piperidin-1-yl]-2-oxoethyl]-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindole-1,3-dione |
| SMILES | NCC1CCCCN1C(=O)CN1C(=O)C2C3CCC(O3)C2C1=O |
| InChI | InChI=1S/C16H23N3O4/c17-7-9-3-1-2-6-18(9)12(20)8-19-15(21)13-10-4-5-11(23-10)14(13)16(19)22/h9-11,13-14H,1-8,17H2 |
| InChIKey | KQIROJRYBLYDHK-UHFFFAOYSA-N |
| XLogP | -0.51 |
| TPSA | 92.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|