C14H21ClN4O4 — CID 119469746
1-[2-[2-(aminomethyl)piperidin-1-yl]-2-oxoethyl]-3-prop-2-enylimidazolidine-2,4,5-trione;hydrochloride (PubChem CID 119469746) has the molecular formula C14H21ClN4O4 and a molecular weight of 344.80 g/mol. Its IUPAC name is 1-[2-[2-(aminomethyl)piperidin-1-yl]-2-oxoethyl]-3-prop-2-enylimidazolidine-2,4,5-trione;hydrochloride.
| Compound Name | 1-[2-[2-(aminomethyl)piperidin-1-yl]-2-oxoethyl]-3-prop-2-enylimidazolidine-2,4,5-trione;hydrochloride |
|---|---|
| PubChem CID | 119469746 |
| Molecular Formula | C14H21ClN4O4 |
| Molecular Weight | 344.80 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | 1-[2-[2-(aminomethyl)piperidin-1-yl]-2-oxoethyl]-3-prop-2-enylimidazolidine-2,4,5-trione;hydrochloride |
| SMILES | C=CCN1C(=O)C(=O)N(CC(=O)N2CCCCC2CN)C1=O.Cl |
| InChI | InChI=1S/C14H20N4O4.ClH/c1-2-6-17-12(20)13(21)18(14(17)22)9-11(19)16-7-4-3-5-10(16)8-15;/h2,10H,1,3-9,15H2;1H |
| InChIKey | QZSRDGSDMPWGJO-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 104.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.80 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|