C15H21ClN4O4 — CID 119639366
1-[2-(3,9-diazabicyclo[4.2.1]nonan-3-yl)-2-oxoethyl]-3-prop-2-enylimidazolidine-2,4,5-trione;hydrochloride (PubChem CID 119639366) has the molecular formula C15H21ClN4O4 and a molecular weight of 356.81 g/mol. Its IUPAC name is 1-[2-(3,9-diazabicyclo[4.2.1]nonan-3-yl)-2-oxoethyl]-3-prop-2-enylimidazolidine-2,4,5-trione;hydrochloride.
| Compound Name | 1-[2-(3,9-diazabicyclo[4.2.1]nonan-3-yl)-2-oxoethyl]-3-prop-2-enylimidazolidine-2,4,5-trione;hydrochloride |
|---|---|
| PubChem CID | 119639366 |
| Molecular Formula | C15H21ClN4O4 |
| Molecular Weight | 356.81 g/mol |
| Exact Mass | 356.13 |
| IUPAC Name | 1-[2-(3,9-diazabicyclo[4.2.1]nonan-3-yl)-2-oxoethyl]-3-prop-2-enylimidazolidine-2,4,5-trione;hydrochloride |
| SMILES | C=CCN1C(=O)C(=O)N(CC(=O)N2CCC3CCC(C2)N3)C1=O.Cl |
| InChI | InChI=1S/C15H20N4O4.ClH/c1-2-6-18-13(21)14(22)19(15(18)23)9-12(20)17-7-5-10-3-4-11(8-17)16-10;/h2,10-11,16H,1,3-9H2;1H |
| InChIKey | AXWZBUKTBNVPBV-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 90.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.81 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|