C12H21ClN2OS — CID 154884938
1-[(1S,6R)-3,9-diazabicyclo[4.2.1]nonan-3-yl]-2-prop-2-enylsulfanylethanone;hydrochloride (PubChem CID 154884938) has the molecular formula C12H21ClN2OS and a molecular weight of 276.83 g/mol. Its IUPAC name is 1-[(1S,6R)-3,9-diazabicyclo[4.2.1]nonan-3-yl]-2-prop-2-enylsulfanylethanone;hydrochloride.
| Compound Name | 1-[(1S,6R)-3,9-diazabicyclo[4.2.1]nonan-3-yl]-2-prop-2-enylsulfanylethanone;hydrochloride |
|---|---|
| PubChem CID | 154884938 |
| Molecular Formula | C12H21ClN2OS |
| Molecular Weight | 276.83 g/mol |
| Exact Mass | 276.11 |
| IUPAC Name | 1-[(1S,6R)-3,9-diazabicyclo[4.2.1]nonan-3-yl]-2-prop-2-enylsulfanylethanone;hydrochloride |
| SMILES | C=CCSCC(=O)N1CC[C@H]2CC[C@@H](C1)N2.Cl |
| InChI | InChI=1S/C12H20N2OS.ClH/c1-2-7-16-9-12(15)14-6-5-10-3-4-11(8-14)13-10;/h2,10-11,13H,1,3-9H2;1H/t10-,11+;/m1./s1 |
| InChIKey | AZKMPZKUJAKMOE-DHXVBOOMSA-N |
| XLogP | 1.68 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.83 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|