C12H22Cl2N2O — CID 119637948
1-(3,9-diazabicyclo[4.2.1]nonan-3-yl)pent-4-en-1-one;dihydrochloride (PubChem CID 119637948) has the molecular formula C12H22Cl2N2O and a molecular weight of 281.23 g/mol. Its IUPAC name is 1-(3,9-diazabicyclo[4.2.1]nonan-3-yl)pent-4-en-1-one;dihydrochloride.
| Compound Name | 1-(3,9-diazabicyclo[4.2.1]nonan-3-yl)pent-4-en-1-one;dihydrochloride |
|---|---|
| PubChem CID | 119637948 |
| Molecular Formula | C12H22Cl2N2O |
| Molecular Weight | 281.23 g/mol |
| Exact Mass | 280.11 |
| IUPAC Name | 1-(3,9-diazabicyclo[4.2.1]nonan-3-yl)pent-4-en-1-one;dihydrochloride |
| SMILES | C=CCCC(=O)N1CCC2CCC(C1)N2.Cl.Cl |
| InChI | InChI=1S/C12H20N2O.2ClH/c1-2-3-4-12(15)14-8-7-10-5-6-11(9-14)13-10;;/h2,10-11,13H,1,3-9H2;2*1H |
| InChIKey | QLBDQIZHMUULNK-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.23 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|