C14H21ClN4O3S — CID 119475097
N-(4-aminocyclohexyl)-2,2-dioxo-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazine-9-carboxamide;hydrochloride (PubChem CID 119475097) has the molecular formula C14H21ClN4O3S and a molecular weight of 360.87 g/mol. Its IUPAC name is N-(4-aminocyclohexyl)-2,2-dioxo-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazine-9-carboxamide;hydrochloride.
| Compound Name | N-(4-aminocyclohexyl)-2,2-dioxo-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazine-9-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119475097 |
| Molecular Formula | C14H21ClN4O3S |
| Molecular Weight | 360.87 g/mol |
| Exact Mass | 360.10 |
| IUPAC Name | N-(4-aminocyclohexyl)-2,2-dioxo-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazine-9-carboxamide;hydrochloride |
| SMILES | Cl.NC1CCC(NC(=O)C2=CC=CN3CCS(=O)(=O)N=C23)CC1 |
| InChI | InChI=1S/C14H20N4O3S.ClH/c15-10-3-5-11(6-4-10)16-14(19)12-2-1-7-18-8-9-22(20,21)17-13(12)18;/h1-2,7,10-11H,3-6,8-9,15H2,(H,16,19);1H |
| InChIKey | IDQSEIYIUMPIRX-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 104.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.87 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |