C14H20N4O3S — CID 120600127
N-(2-methylpiperidin-4-yl)-2,2-dioxo-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazine-9-carboxamide (PubChem CID 120600127) has the molecular formula C14H20N4O3S and a molecular weight of 324.41 g/mol. Its IUPAC name is N-(2-methylpiperidin-4-yl)-2,2-dioxo-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazine-9-carboxamide.
| Compound Name | N-(2-methylpiperidin-4-yl)-2,2-dioxo-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazine-9-carboxamide |
|---|---|
| PubChem CID | 120600127 |
| Molecular Formula | C14H20N4O3S |
| Molecular Weight | 324.41 g/mol |
| Exact Mass | 324.13 |
| IUPAC Name | N-(2-methylpiperidin-4-yl)-2,2-dioxo-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazine-9-carboxamide |
| SMILES | CC1CC(NC(=O)C2=CC=CN3CCS(=O)(=O)N=C23)CCN1 |
| InChI | InChI=1S/C14H20N4O3S/c1-10-9-11(4-5-15-10)16-14(19)12-3-2-6-18-7-8-22(20,21)17-13(12)18/h2-3,6,10-11,15H,4-5,7-9H2,1H3,(H,16,19) |
| InChIKey | XIASSLNJZFWDDS-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 90.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.41 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |