C29H30F2N6O2 — CID 11947934
N-cyclopropyl-3-[8-(2,6-difluorophenyl)-7-oxo-2-[2-(propylamino)ethylamino]pyrido[2,3-d]pyrimidin-4-yl]-4-methylbenzamide (PubChem CID 11947934) has the molecular formula C29H30F2N6O2 and a molecular weight of 532.60 g/mol. Its IUPAC name is N-cyclopropyl-3-[8-(2,6-difluorophenyl)-7-oxo-2-[2-(propylamino)ethylamino]pyrido[2,3-d]pyrimidin-4-yl]-4-methylbenzamide.
| Compound Name | N-cyclopropyl-3-[8-(2,6-difluorophenyl)-7-oxo-2-[2-(propylamino)ethylamino]pyrido[2,3-d]pyrimidin-4-yl]-4-methylbenzamide |
|---|---|
| PubChem CID | 11947934 |
| Molecular Formula | C29H30F2N6O2 |
| Molecular Weight | 532.60 g/mol |
| Exact Mass | 532.24 |
| IUPAC Name | N-cyclopropyl-3-[8-(2,6-difluorophenyl)-7-oxo-2-[2-(propylamino)ethylamino]pyrido[2,3-d]pyrimidin-4-yl]-4-methylbenzamide |
| SMILES | CCCNCCNc1nc(-c2cc(C(=O)NC3CC3)ccc2C)c2ccc(=O)n(-c3c(F)cccc3F)c2n1 |
| InChI | InChI=1S/C29H30F2N6O2/c1-3-13-32-14-15-33-29-35-25(21-16-18(8-7-17(21)2)28(39)34-19-9-10-19)20-11-12-24(38)37(27(20)36-29)26-22(30)5-4-6-23(26)31/h4-8,11-12,16,19,32H,3,9-10,13-15H2,1-2H3,(H,34,39)(H,33,35,36) |
| InChIKey | HERQNPYFYWKYLH-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 100.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.60 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|