C16H24N2O8S — CID 11948729
methyl 2-[[2-(3-methoxypropylamino)acetyl]amino]-4,5-dimethylthiophene-3-carboxylate;oxalic acid (PubChem CID 11948729) has the molecular formula C16H24N2O8S and a molecular weight of 404.44 g/mol. Its IUPAC name is methyl 2-[[2-(3-methoxypropylamino)acetyl]amino]-4,5-dimethylthiophene-3-carboxylate;oxalic acid.
| Compound Name | methyl 2-[[2-(3-methoxypropylamino)acetyl]amino]-4,5-dimethylthiophene-3-carboxylate;oxalic acid |
|---|---|
| PubChem CID | 11948729 |
| Molecular Formula | C16H24N2O8S |
| Molecular Weight | 404.44 g/mol |
| Exact Mass | 404.13 |
| IUPAC Name | methyl 2-[[2-(3-methoxypropylamino)acetyl]amino]-4,5-dimethylthiophene-3-carboxylate;oxalic acid |
| SMILES | COCCCNCC(=O)Nc1sc(C)c(C)c1C(=O)OC.O=C(O)C(=O)O |
| InChI | InChI=1S/C14H22N2O4S.C2H2O4/c1-9-10(2)21-13(12(9)14(18)20-4)16-11(17)8-15-6-5-7-19-3;3-1(4)2(5)6/h15H,5-8H2,1-4H3,(H,16,17);(H,3,4)(H,5,6) |
| InChIKey | ZIFUOMVTDUVICF-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 151.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.44 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|