C17H35Cl2N3O2 — CID 119491433
3-ethyl-1-[3-(methylamino)piperidin-1-yl]-2-morpholin-4-ylpentan-1-one;dihydrochloride (PubChem CID 119491433) has the molecular formula C17H35Cl2N3O2 and a molecular weight of 384.39 g/mol. Its IUPAC name is 3-ethyl-1-[3-(methylamino)piperidin-1-yl]-2-morpholin-4-ylpentan-1-one;dihydrochloride.
| Compound Name | 3-ethyl-1-[3-(methylamino)piperidin-1-yl]-2-morpholin-4-ylpentan-1-one;dihydrochloride |
|---|---|
| PubChem CID | 119491433 |
| Molecular Formula | C17H35Cl2N3O2 |
| Molecular Weight | 384.39 g/mol |
| Exact Mass | 383.21 |
| IUPAC Name | 3-ethyl-1-[3-(methylamino)piperidin-1-yl]-2-morpholin-4-ylpentan-1-one;dihydrochloride |
| SMILES | CCC(CC)C(C(=O)N1CCCC(NC)C1)N1CCOCC1.Cl.Cl |
| InChI | InChI=1S/C17H33N3O2.2ClH/c1-4-14(5-2)16(19-9-11-22-12-10-19)17(21)20-8-6-7-15(13-20)18-3;;/h14-16,18H,4-13H2,1-3H3;2*1H |
| InChIKey | ZEJDONINVFATFG-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.39 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |