C15H22ClFN2O3S — CID 119492871
2-(4-fluorophenyl)sulfonyl-1-[3-(methylamino)piperidin-1-yl]propan-1-one;hydrochloride (PubChem CID 119492871) has the molecular formula C15H22ClFN2O3S and a molecular weight of 364.87 g/mol. Its IUPAC name is 2-(4-fluorophenyl)sulfonyl-1-[3-(methylamino)piperidin-1-yl]propan-1-one;hydrochloride.
| Compound Name | 2-(4-fluorophenyl)sulfonyl-1-[3-(methylamino)piperidin-1-yl]propan-1-one;hydrochloride |
|---|---|
| PubChem CID | 119492871 |
| Molecular Formula | C15H22ClFN2O3S |
| Molecular Weight | 364.87 g/mol |
| Exact Mass | 364.10 |
| IUPAC Name | 2-(4-fluorophenyl)sulfonyl-1-[3-(methylamino)piperidin-1-yl]propan-1-one;hydrochloride |
| SMILES | CNC1CCCN(C(=O)C(C)S(=O)(=O)c2ccc(F)cc2)C1.Cl |
| InChI | InChI=1S/C15H21FN2O3S.ClH/c1-11(15(19)18-9-3-4-13(10-18)17-2)22(20,21)14-7-5-12(16)6-8-14;/h5-8,11,13,17H,3-4,9-10H2,1-2H3;1H |
| InChIKey | CVPYSCQXXUNSHK-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.87 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |