C16H21FN2O2S — CID 119493082
2-(4-acetyl-3-fluorophenyl)sulfanyl-1-[3-(methylamino)piperidin-1-yl]ethanone (PubChem CID 119493082) has the molecular formula C16H21FN2O2S and a molecular weight of 324.42 g/mol. Its IUPAC name is 2-(4-acetyl-3-fluorophenyl)sulfanyl-1-[3-(methylamino)piperidin-1-yl]ethanone.
| Compound Name | 2-(4-acetyl-3-fluorophenyl)sulfanyl-1-[3-(methylamino)piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 119493082 |
| Molecular Formula | C16H21FN2O2S |
| Molecular Weight | 324.42 g/mol |
| Exact Mass | 324.13 |
| IUPAC Name | 2-(4-acetyl-3-fluorophenyl)sulfanyl-1-[3-(methylamino)piperidin-1-yl]ethanone |
| SMILES | CNC1CCCN(C(=O)CSc2ccc(C(C)=O)c(F)c2)C1 |
| InChI | InChI=1S/C16H21FN2O2S/c1-11(20)14-6-5-13(8-15(14)17)22-10-16(21)19-7-3-4-12(9-19)18-2/h5-6,8,12,18H,3-4,7,9-10H2,1-2H3 |
| InChIKey | MZVXHVAEPGTDLG-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.42 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |