C13H27N3O2 — CID 119495804
N-(3-aminobutyl)-N',N'-diethylpentanediamide (PubChem CID 119495804) has the molecular formula C13H27N3O2 and a molecular weight of 257.38 g/mol. Its IUPAC name is N-(3-aminobutyl)-N',N'-diethylpentanediamide.
| Compound Name | N-(3-aminobutyl)-N',N'-diethylpentanediamide |
|---|---|
| PubChem CID | 119495804 |
| Molecular Formula | C13H27N3O2 |
| Molecular Weight | 257.38 g/mol |
| Exact Mass | 257.21 |
| IUPAC Name | N-(3-aminobutyl)-N',N'-diethylpentanediamide |
| SMILES | CCN(CC)C(=O)CCCC(=O)NCCC(C)N |
| InChI | InChI=1S/C13H27N3O2/c1-4-16(5-2)13(18)8-6-7-12(17)15-10-9-11(3)14/h11H,4-10,14H2,1-3H3,(H,15,17) |
| InChIKey | ONHRTWIVTRZNDK-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.38 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |