C23H25NO6 — CID 11949583
(E,2R)-5-(4-methoxycarbonylphenyl)-2,4-dimethyl-5-(phenylmethoxycarbonylamino)pent-3-enoic acid (PubChem CID 11949583) has the molecular formula C23H25NO6 and a molecular weight of 411.45 g/mol. Its IUPAC name is (E,2R)-5-(4-methoxycarbonylphenyl)-2,4-dimethyl-5-(phenylmethoxycarbonylamino)pent-3-enoic acid.
| Compound Name | (E,2R)-5-(4-methoxycarbonylphenyl)-2,4-dimethyl-5-(phenylmethoxycarbonylamino)pent-3-enoic acid |
|---|---|
| PubChem CID | 11949583 |
| Molecular Formula | C23H25NO6 |
| Molecular Weight | 411.45 g/mol |
| Exact Mass | 411.17 |
| IUPAC Name | (E,2R)-5-(4-methoxycarbonylphenyl)-2,4-dimethyl-5-(phenylmethoxycarbonylamino)pent-3-enoic acid |
| SMILES | COC(=O)c1ccc(C(NC(=O)OCc2ccccc2)/C(C)=C/[C@@H](C)C(=O)O)cc1 |
| InChI | InChI=1S/C23H25NO6/c1-15(13-16(2)21(25)26)20(18-9-11-19(12-10-18)22(27)29-3)24-23(28)30-14-17-7-5-4-6-8-17/h4-13,16,20H,14H2,1-3H3,(H,24,28)(H,25,26)/b15-13+/t16-,20?/m1/s1 |
| InChIKey | UNNZHBCIYNXXIA-OXVKMINTSA-N |
| XLogP | 4.11 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.45 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|