C23H25IN2O5 — CID 5459563
methyl 4-[(Z,4R)-2-iodo-4-methyl-5-(methylamino)-5-oxo-1-(phenylmethoxycarbonylamino)pent-2-enyl]benzoate (PubChem CID 5459563) has the molecular formula C23H25IN2O5 and a molecular weight of 536.37 g/mol. Its IUPAC name is methyl 4-[(Z,4R)-2-iodo-4-methyl-5-(methylamino)-5-oxo-1-(phenylmethoxycarbonylamino)pent-2-enyl]benzoate.
| Compound Name | methyl 4-[(Z,4R)-2-iodo-4-methyl-5-(methylamino)-5-oxo-1-(phenylmethoxycarbonylamino)pent-2-enyl]benzoate |
|---|---|
| PubChem CID | 5459563 |
| Molecular Formula | C23H25IN2O5 |
| Molecular Weight | 536.37 g/mol |
| Exact Mass | 536.08 |
| IUPAC Name | methyl 4-[(Z,4R)-2-iodo-4-methyl-5-(methylamino)-5-oxo-1-(phenylmethoxycarbonylamino)pent-2-enyl]benzoate |
| SMILES | CNC(=O)[C@H](C)/C=C(\I)C(NC(=O)OCc1ccccc1)c1ccc(C(=O)OC)cc1 |
| InChI | InChI=1S/C23H25IN2O5/c1-15(21(27)25-2)13-19(24)20(17-9-11-18(12-10-17)22(28)30-3)26-23(29)31-14-16-7-5-4-6-8-16/h4-13,15,20H,14H2,1-3H3,(H,25,27)(H,26,29)/b19-13-/t15-,20?/m1/s1 |
| InChIKey | OCUGEZKVSDFHEL-BISYGVQWSA-N |
| XLogP | 4.14 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.37 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|