C10H14F2N2O3S2 — CID 119495837
N-(3-aminobutyl)-3-(difluoromethylsulfonyl)thiophene-2-carboxamide (PubChem CID 119495837) has the molecular formula C10H14F2N2O3S2 and a molecular weight of 312.36 g/mol. Its IUPAC name is N-(3-aminobutyl)-3-(difluoromethylsulfonyl)thiophene-2-carboxamide.
| Compound Name | N-(3-aminobutyl)-3-(difluoromethylsulfonyl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 119495837 |
| Molecular Formula | C10H14F2N2O3S2 |
| Molecular Weight | 312.36 g/mol |
| Exact Mass | 312.04 |
| IUPAC Name | N-(3-aminobutyl)-3-(difluoromethylsulfonyl)thiophene-2-carboxamide |
| SMILES | CC(N)CCNC(=O)c1sccc1S(=O)(=O)C(F)F |
| InChI | InChI=1S/C10H14F2N2O3S2/c1-6(13)2-4-14-9(15)8-7(3-5-18-8)19(16,17)10(11)12/h3,5-6,10H,2,4,13H2,1H3,(H,14,15) |
| InChIKey | KXOSCTLGOPZXSB-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.36 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |