C10H12F2N2O3S2 — CID 119450494
3-(difluoromethylsulfonyl)-N-pyrrolidin-3-ylthiophene-2-carboxamide (PubChem CID 119450494) has the molecular formula C10H12F2N2O3S2 and a molecular weight of 310.35 g/mol. Its IUPAC name is 3-(difluoromethylsulfonyl)-N-pyrrolidin-3-ylthiophene-2-carboxamide.
| Compound Name | 3-(difluoromethylsulfonyl)-N-pyrrolidin-3-ylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 119450494 |
| Molecular Formula | C10H12F2N2O3S2 |
| Molecular Weight | 310.35 g/mol |
| Exact Mass | 310.03 |
| IUPAC Name | 3-(difluoromethylsulfonyl)-N-pyrrolidin-3-ylthiophene-2-carboxamide |
| SMILES | O=C(NC1CCNC1)c1sccc1S(=O)(=O)C(F)F |
| InChI | InChI=1S/C10H12F2N2O3S2/c11-10(12)19(16,17)7-2-4-18-8(7)9(15)14-6-1-3-13-5-6/h2,4,6,10,13H,1,3,5H2,(H,14,15) |
| InChIKey | KDQOVBBTMFHVCI-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.35 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |