C14H18ClN3O3S3 — CID 119451091
N-pyrrolidin-3-yl-3-(thiophen-2-ylmethylsulfamoyl)thiophene-2-carboxamide;hydrochloride (PubChem CID 119451091) has the molecular formula C14H18ClN3O3S3 and a molecular weight of 407.97 g/mol. Its IUPAC name is N-pyrrolidin-3-yl-3-(thiophen-2-ylmethylsulfamoyl)thiophene-2-carboxamide;hydrochloride.
| Compound Name | N-pyrrolidin-3-yl-3-(thiophen-2-ylmethylsulfamoyl)thiophene-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119451091 |
| Molecular Formula | C14H18ClN3O3S3 |
| Molecular Weight | 407.97 g/mol |
| Exact Mass | 407.02 |
| IUPAC Name | N-pyrrolidin-3-yl-3-(thiophen-2-ylmethylsulfamoyl)thiophene-2-carboxamide;hydrochloride |
| SMILES | Cl.O=C(NC1CCNC1)c1sccc1S(=O)(=O)NCc1cccs1 |
| InChI | InChI=1S/C14H17N3O3S3.ClH/c18-14(17-10-3-5-15-8-10)13-12(4-7-22-13)23(19,20)16-9-11-2-1-6-21-11;/h1-2,4,6-7,10,15-16H,3,5,8-9H2,(H,17,18);1H |
| InChIKey | UOUDGSIGHCHDDL-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.97 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |