C16H20N2O4S3 — CID 86900163
N-[2-(cyclopropylmethoxy)ethyl]-3-(thiophen-2-ylmethylsulfamoyl)thiophene-2-carboxamide (PubChem CID 86900163) has the molecular formula C16H20N2O4S3 and a molecular weight of 400.55 g/mol. Its IUPAC name is N-[2-(cyclopropylmethoxy)ethyl]-3-(thiophen-2-ylmethylsulfamoyl)thiophene-2-carboxamide.
| Compound Name | N-[2-(cyclopropylmethoxy)ethyl]-3-(thiophen-2-ylmethylsulfamoyl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 86900163 |
| Molecular Formula | C16H20N2O4S3 |
| Molecular Weight | 400.55 g/mol |
| Exact Mass | 400.06 |
| IUPAC Name | N-[2-(cyclopropylmethoxy)ethyl]-3-(thiophen-2-ylmethylsulfamoyl)thiophene-2-carboxamide |
| SMILES | O=C(NCCOCC1CC1)c1sccc1S(=O)(=O)NCc1cccs1 |
| InChI | InChI=1S/C16H20N2O4S3/c19-16(17-6-7-22-11-12-3-4-12)15-14(5-9-24-15)25(20,21)18-10-13-2-1-8-23-13/h1-2,5,8-9,12,18H,3-4,6-7,10-11H2,(H,17,19) |
| InChIKey | VWIKWTHYRUWRNM-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.55 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|