C11H16F2N2O2S — CID 119499716
N-(3-aminobutyl)-3-(difluoromethoxy)-5-methylthiophene-2-carboxamide (PubChem CID 119499716) has the molecular formula C11H16F2N2O2S and a molecular weight of 278.32 g/mol. Its IUPAC name is N-(3-aminobutyl)-3-(difluoromethoxy)-5-methylthiophene-2-carboxamide.
| Compound Name | N-(3-aminobutyl)-3-(difluoromethoxy)-5-methylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 119499716 |
| Molecular Formula | C11H16F2N2O2S |
| Molecular Weight | 278.32 g/mol |
| Exact Mass | 278.09 |
| IUPAC Name | N-(3-aminobutyl)-3-(difluoromethoxy)-5-methylthiophene-2-carboxamide |
| SMILES | Cc1cc(OC(F)F)c(C(=O)NCCC(C)N)s1 |
| InChI | InChI=1S/C11H16F2N2O2S/c1-6(14)3-4-15-10(16)9-8(17-11(12)13)5-7(2)18-9/h5-6,11H,3-4,14H2,1-2H3,(H,15,16) |
| InChIKey | WIDJHBJADYPWCU-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.32 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |