C20H25N3O4 — CID 119498635
N-(3-aminobutyl)-2-benzamido-4,5-dimethoxybenzamide (PubChem CID 119498635) has the molecular formula C20H25N3O4 and a molecular weight of 371.44 g/mol. Its IUPAC name is N-(3-aminobutyl)-2-benzamido-4,5-dimethoxybenzamide.
| Compound Name | N-(3-aminobutyl)-2-benzamido-4,5-dimethoxybenzamide |
|---|---|
| PubChem CID | 119498635 |
| Molecular Formula | C20H25N3O4 |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.18 |
| IUPAC Name | N-(3-aminobutyl)-2-benzamido-4,5-dimethoxybenzamide |
| SMILES | COc1cc(NC(=O)c2ccccc2)c(C(=O)NCCC(C)N)cc1OC |
| InChI | InChI=1S/C20H25N3O4/c1-13(21)9-10-22-20(25)15-11-17(26-2)18(27-3)12-16(15)23-19(24)14-7-5-4-6-8-14/h4-8,11-13H,9-10,21H2,1-3H3,(H,22,25)(H,23,24) |
| InChIKey | QWCVICUQLNZVOB-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 102.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |