C12H20N4O3S2 — CID 119503707
N-[2-(methylamino)ethyl]-4-thiomorpholin-4-ylsulfonyl-1H-pyrrole-2-carboxamide (PubChem CID 119503707) has the molecular formula C12H20N4O3S2 and a molecular weight of 332.45 g/mol. Its IUPAC name is N-[2-(methylamino)ethyl]-4-thiomorpholin-4-ylsulfonyl-1H-pyrrole-2-carboxamide.
| Compound Name | N-[2-(methylamino)ethyl]-4-thiomorpholin-4-ylsulfonyl-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 119503707 |
| Molecular Formula | C12H20N4O3S2 |
| Molecular Weight | 332.45 g/mol |
| Exact Mass | 332.10 |
| IUPAC Name | N-[2-(methylamino)ethyl]-4-thiomorpholin-4-ylsulfonyl-1H-pyrrole-2-carboxamide |
| SMILES | CNCCNC(=O)c1cc(S(=O)(=O)N2CCSCC2)c[nH]1 |
| InChI | InChI=1S/C12H20N4O3S2/c1-13-2-3-14-12(17)11-8-10(9-15-11)21(18,19)16-4-6-20-7-5-16/h8-9,13,15H,2-7H2,1H3,(H,14,17) |
| InChIKey | MZXJWTQBAFXGJS-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 94.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.45 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|