C17H29N3O3S2 — CID 60591054
N-(2-ethylhexyl)-4-thiomorpholin-4-ylsulfonyl-1H-pyrrole-2-carboxamide (PubChem CID 60591054) has the molecular formula C17H29N3O3S2 and a molecular weight of 387.57 g/mol. Its IUPAC name is N-(2-ethylhexyl)-4-thiomorpholin-4-ylsulfonyl-1H-pyrrole-2-carboxamide.
| Compound Name | N-(2-ethylhexyl)-4-thiomorpholin-4-ylsulfonyl-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 60591054 |
| Molecular Formula | C17H29N3O3S2 |
| Molecular Weight | 387.57 g/mol |
| Exact Mass | 387.17 |
| IUPAC Name | N-(2-ethylhexyl)-4-thiomorpholin-4-ylsulfonyl-1H-pyrrole-2-carboxamide |
| SMILES | CCCCC(CC)CNC(=O)c1cc(S(=O)(=O)N2CCSCC2)c[nH]1 |
| InChI | InChI=1S/C17H29N3O3S2/c1-3-5-6-14(4-2)12-19-17(21)16-11-15(13-18-16)25(22,23)20-7-9-24-10-8-20/h11,13-14,18H,3-10,12H2,1-2H3,(H,19,21) |
| InChIKey | WWBMNXBNZSUCPS-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 82.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.57 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |