C22H23N3O3S2 — CID 60591230
N-benzhydryl-4-thiomorpholin-4-ylsulfonyl-1H-pyrrole-2-carboxamide (PubChem CID 60591230) has the molecular formula C22H23N3O3S2 and a molecular weight of 441.58 g/mol. Its IUPAC name is N-benzhydryl-4-thiomorpholin-4-ylsulfonyl-1H-pyrrole-2-carboxamide.
| Compound Name | N-benzhydryl-4-thiomorpholin-4-ylsulfonyl-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 60591230 |
| Molecular Formula | C22H23N3O3S2 |
| Molecular Weight | 441.58 g/mol |
| Exact Mass | 441.12 |
| IUPAC Name | N-benzhydryl-4-thiomorpholin-4-ylsulfonyl-1H-pyrrole-2-carboxamide |
| SMILES | O=C(NC(c1ccccc1)c1ccccc1)c1cc(S(=O)(=O)N2CCSCC2)c[nH]1 |
| InChI | InChI=1S/C22H23N3O3S2/c26-22(20-15-19(16-23-20)30(27,28)25-11-13-29-14-12-25)24-21(17-7-3-1-4-8-17)18-9-5-2-6-10-18/h1-10,15-16,21,23H,11-14H2,(H,24,26) |
| InChIKey | RXURZELYJNXSSJ-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 82.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.58 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |