C15H16IN3O3S2 — CID 60591022
N-(3-iodophenyl)-4-thiomorpholin-4-ylsulfonyl-1H-pyrrole-2-carboxamide (PubChem CID 60591022) has the molecular formula C15H16IN3O3S2 and a molecular weight of 477.35 g/mol. Its IUPAC name is N-(3-iodophenyl)-4-thiomorpholin-4-ylsulfonyl-1H-pyrrole-2-carboxamide.
| Compound Name | N-(3-iodophenyl)-4-thiomorpholin-4-ylsulfonyl-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 60591022 |
| Molecular Formula | C15H16IN3O3S2 |
| Molecular Weight | 477.35 g/mol |
| Exact Mass | 476.97 |
| IUPAC Name | N-(3-iodophenyl)-4-thiomorpholin-4-ylsulfonyl-1H-pyrrole-2-carboxamide |
| SMILES | O=C(Nc1cccc(I)c1)c1cc(S(=O)(=O)N2CCSCC2)c[nH]1 |
| InChI | InChI=1S/C15H16IN3O3S2/c16-11-2-1-3-12(8-11)18-15(20)14-9-13(10-17-14)24(21,22)19-4-6-23-7-5-19/h1-3,8-10,17H,4-7H2,(H,18,20) |
| InChIKey | KNJBSASVWDEAAU-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 82.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.35 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|