C15H18N4O3S2 — CID 51126293
N-(pyridin-4-ylmethyl)-4-thiomorpholin-4-ylsulfonyl-1H-pyrrole-2-carboxamide (PubChem CID 51126293) has the molecular formula C15H18N4O3S2 and a molecular weight of 366.47 g/mol. Its IUPAC name is N-(pyridin-4-ylmethyl)-4-thiomorpholin-4-ylsulfonyl-1H-pyrrole-2-carboxamide.
| Compound Name | N-(pyridin-4-ylmethyl)-4-thiomorpholin-4-ylsulfonyl-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 51126293 |
| Molecular Formula | C15H18N4O3S2 |
| Molecular Weight | 366.47 g/mol |
| Exact Mass | 366.08 |
| IUPAC Name | N-(pyridin-4-ylmethyl)-4-thiomorpholin-4-ylsulfonyl-1H-pyrrole-2-carboxamide |
| SMILES | O=C(NCc1ccncc1)c1cc(S(=O)(=O)N2CCSCC2)c[nH]1 |
| InChI | InChI=1S/C15H18N4O3S2/c20-15(18-10-12-1-3-16-4-2-12)14-9-13(11-17-14)24(21,22)19-5-7-23-8-6-19/h1-4,9,11,17H,5-8,10H2,(H,18,20) |
| InChIKey | CTSCGCUAHUPMON-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 95.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.47 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |