C13H23Cl2N3OS — CID 119503859
2-cyclopentyl-4-methyl-N-[2-(methylamino)ethyl]-1,3-thiazole-5-carboxamide;dihydrochloride (PubChem CID 119503859) has the molecular formula C13H23Cl2N3OS and a molecular weight of 340.32 g/mol. Its IUPAC name is 2-cyclopentyl-4-methyl-N-[2-(methylamino)ethyl]-1,3-thiazole-5-carboxamide;dihydrochloride.
| Compound Name | 2-cyclopentyl-4-methyl-N-[2-(methylamino)ethyl]-1,3-thiazole-5-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 119503859 |
| Molecular Formula | C13H23Cl2N3OS |
| Molecular Weight | 340.32 g/mol |
| Exact Mass | 339.09 |
| IUPAC Name | 2-cyclopentyl-4-methyl-N-[2-(methylamino)ethyl]-1,3-thiazole-5-carboxamide;dihydrochloride |
| SMILES | CNCCNC(=O)c1sc(C2CCCC2)nc1C.Cl.Cl |
| InChI | InChI=1S/C13H21N3OS.2ClH/c1-9-11(12(17)15-8-7-14-2)18-13(16-9)10-5-3-4-6-10;;/h10,14H,3-8H2,1-2H3,(H,15,17);2*1H |
| InChIKey | MBDICYDKTYUTAZ-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.32 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|