C17H20Cl2N4OS — CID 119509052
1-(2-chlorophenyl)-N-[2-(ethylamino)ethyl]-3-methylthieno[3,2-d]pyrazole-5-carboxamide;hydrochloride (PubChem CID 119509052) has the molecular formula C17H20Cl2N4OS and a molecular weight of 399.35 g/mol. Its IUPAC name is 1-(2-chlorophenyl)-N-[2-(ethylamino)ethyl]-3-methylthieno[3,2-d]pyrazole-5-carboxamide;hydrochloride.
| Compound Name | 1-(2-chlorophenyl)-N-[2-(ethylamino)ethyl]-3-methylthieno[3,2-d]pyrazole-5-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119509052 |
| Molecular Formula | C17H20Cl2N4OS |
| Molecular Weight | 399.35 g/mol |
| Exact Mass | 398.07 |
| IUPAC Name | 1-(2-chlorophenyl)-N-[2-(ethylamino)ethyl]-3-methylthieno[3,2-d]pyrazole-5-carboxamide;hydrochloride |
| SMILES | CCNCCNC(=O)c1cc2c(C)nn(-c3ccccc3Cl)c2s1.Cl |
| InChI | InChI=1S/C17H19ClN4OS.ClH/c1-3-19-8-9-20-16(23)15-10-12-11(2)21-22(17(12)24-15)14-7-5-4-6-13(14)18;/h4-7,10,19H,3,8-9H2,1-2H3,(H,20,23);1H |
| InChIKey | YAMYMGLFLTVQQR-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.35 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|