C18H19ClN4O3S — CID 56557657
ethyl N-[2-[[1-(2-chlorophenyl)-3-methylthieno[3,2-d]pyrazole-5-carbonyl]amino]ethyl]carbamate (PubChem CID 56557657) has the molecular formula C18H19ClN4O3S and a molecular weight of 406.90 g/mol. Its IUPAC name is ethyl N-[2-[[1-(2-chlorophenyl)-3-methylthieno[3,2-d]pyrazole-5-carbonyl]amino]ethyl]carbamate.
| Compound Name | ethyl N-[2-[[1-(2-chlorophenyl)-3-methylthieno[3,2-d]pyrazole-5-carbonyl]amino]ethyl]carbamate |
|---|---|
| PubChem CID | 56557657 |
| Molecular Formula | C18H19ClN4O3S |
| Molecular Weight | 406.90 g/mol |
| Exact Mass | 406.09 |
| IUPAC Name | ethyl N-[2-[[1-(2-chlorophenyl)-3-methylthieno[3,2-d]pyrazole-5-carbonyl]amino]ethyl]carbamate |
| SMILES | CCOC(=O)NCCNC(=O)c1cc2c(C)nn(-c3ccccc3Cl)c2s1 |
| InChI | InChI=1S/C18H19ClN4O3S/c1-3-26-18(25)21-9-8-20-16(24)15-10-12-11(2)22-23(17(12)27-15)14-7-5-4-6-13(14)19/h4-7,10H,3,8-9H2,1-2H3,(H,20,24)(H,21,25) |
| InChIKey | KVDIHOLUMNUWET-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 85.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.90 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|