C19H21F3N2O2S — CID 119517623
[4-(1-aminoethyl)piperidin-1-yl]-[5-[4-(trifluoromethoxy)phenyl]thiophen-2-yl]methanone (PubChem CID 119517623) has the molecular formula C19H21F3N2O2S and a molecular weight of 398.45 g/mol. Its IUPAC name is [4-(1-aminoethyl)piperidin-1-yl]-[5-[4-(trifluoromethoxy)phenyl]thiophen-2-yl]methanone.
| Compound Name | [4-(1-aminoethyl)piperidin-1-yl]-[5-[4-(trifluoromethoxy)phenyl]thiophen-2-yl]methanone |
|---|---|
| PubChem CID | 119517623 |
| Molecular Formula | C19H21F3N2O2S |
| Molecular Weight | 398.45 g/mol |
| Exact Mass | 398.13 |
| IUPAC Name | [4-(1-aminoethyl)piperidin-1-yl]-[5-[4-(trifluoromethoxy)phenyl]thiophen-2-yl]methanone |
| SMILES | CC(N)C1CCN(C(=O)c2ccc(-c3ccc(OC(F)(F)F)cc3)s2)CC1 |
| InChI | InChI=1S/C19H21F3N2O2S/c1-12(23)13-8-10-24(11-9-13)18(25)17-7-6-16(27-17)14-2-4-15(5-3-14)26-19(20,21)22/h2-7,12-13H,8-11,23H2,1H3 |
| InChIKey | CQZDFRRWROCXMC-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.45 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |