C16H17F3N2O2S — CID 119582143
N-(1-aminopropan-2-yl)-N-methyl-5-[4-(trifluoromethoxy)phenyl]thiophene-2-carboxamide (PubChem CID 119582143) has the molecular formula C16H17F3N2O2S and a molecular weight of 358.39 g/mol. Its IUPAC name is N-(1-aminopropan-2-yl)-N-methyl-5-[4-(trifluoromethoxy)phenyl]thiophene-2-carboxamide.
| Compound Name | N-(1-aminopropan-2-yl)-N-methyl-5-[4-(trifluoromethoxy)phenyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 119582143 |
| Molecular Formula | C16H17F3N2O2S |
| Molecular Weight | 358.39 g/mol |
| Exact Mass | 358.10 |
| IUPAC Name | N-(1-aminopropan-2-yl)-N-methyl-5-[4-(trifluoromethoxy)phenyl]thiophene-2-carboxamide |
| SMILES | CC(CN)N(C)C(=O)c1ccc(-c2ccc(OC(F)(F)F)cc2)s1 |
| InChI | InChI=1S/C16H17F3N2O2S/c1-10(9-20)21(2)15(22)14-8-7-13(24-14)11-3-5-12(6-4-11)23-16(17,18)19/h3-8,10H,9,20H2,1-2H3 |
| InChIKey | AUFVKFQKELARBB-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.39 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |