C21H24N4OS — CID 119519370
[4-(1-aminoethyl)piperidin-1-yl]-(1-phenyl-5-thiophen-2-ylpyrazol-3-yl)methanone (PubChem CID 119519370) has the molecular formula C21H24N4OS and a molecular weight of 380.52 g/mol. Its IUPAC name is [4-(1-aminoethyl)piperidin-1-yl]-(1-phenyl-5-thiophen-2-ylpyrazol-3-yl)methanone.
| Compound Name | [4-(1-aminoethyl)piperidin-1-yl]-(1-phenyl-5-thiophen-2-ylpyrazol-3-yl)methanone |
|---|---|
| PubChem CID | 119519370 |
| Molecular Formula | C21H24N4OS |
| Molecular Weight | 380.52 g/mol |
| Exact Mass | 380.17 |
| IUPAC Name | [4-(1-aminoethyl)piperidin-1-yl]-(1-phenyl-5-thiophen-2-ylpyrazol-3-yl)methanone |
| SMILES | CC(N)C1CCN(C(=O)c2cc(-c3cccs3)n(-c3ccccc3)n2)CC1 |
| InChI | InChI=1S/C21H24N4OS/c1-15(22)16-9-11-24(12-10-16)21(26)18-14-19(20-8-5-13-27-20)25(23-18)17-6-3-2-4-7-17/h2-8,13-16H,9-12,22H2,1H3 |
| InChIKey | SMAFHHJADMRKJM-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 64.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.52 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |