C14H9BrN2O2S — CID 43542791
1-(2-bromophenyl)-5-thiophen-2-ylpyrazole-3-carboxylic acid (PubChem CID 43542791) has the molecular formula C14H9BrN2O2S and a molecular weight of 349.21 g/mol. Its IUPAC name is 1-(2-bromophenyl)-5-thiophen-2-ylpyrazole-3-carboxylic acid.
| Compound Name | 1-(2-bromophenyl)-5-thiophen-2-ylpyrazole-3-carboxylic acid |
|---|---|
| PubChem CID | 43542791 |
| Molecular Formula | C14H9BrN2O2S |
| Molecular Weight | 349.21 g/mol |
| Exact Mass | 347.96 |
| IUPAC Name | 1-(2-bromophenyl)-5-thiophen-2-ylpyrazole-3-carboxylic acid |
| SMILES | O=C(O)c1cc(-c2cccs2)n(-c2ccccc2Br)n1 |
| InChI | InChI=1S/C14H9BrN2O2S/c15-9-4-1-2-5-11(9)17-12(13-6-3-7-20-13)8-10(16-17)14(18)19/h1-8H,(H,18,19) |
| InChIKey | MSGJSCKSBFIBMJ-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.21 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |