C14H10N2O3S — CID 82362023
1-(2-hydroxyphenyl)-5-thiophen-2-ylpyrazole-3-carboxylic acid (PubChem CID 82362023) has the molecular formula C14H10N2O3S and a molecular weight of 286.31 g/mol. Its IUPAC name is 1-(2-hydroxyphenyl)-5-thiophen-2-ylpyrazole-3-carboxylic acid.
| Compound Name | 1-(2-hydroxyphenyl)-5-thiophen-2-ylpyrazole-3-carboxylic acid |
|---|---|
| PubChem CID | 82362023 |
| Molecular Formula | C14H10N2O3S |
| Molecular Weight | 286.31 g/mol |
| Exact Mass | 286.04 |
| IUPAC Name | 1-(2-hydroxyphenyl)-5-thiophen-2-ylpyrazole-3-carboxylic acid |
| SMILES | O=C(O)c1cc(-c2cccs2)n(-c2ccccc2O)n1 |
| InChI | InChI=1S/C14H10N2O3S/c17-12-5-2-1-4-10(12)16-11(13-6-3-7-20-13)8-9(15-16)14(18)19/h1-8,17H,(H,18,19) |
| InChIKey | KSWSBTJBOGZIQD-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.31 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |