C19H15FN4OS — CID 146076048
3-fluoro-1-(1-phenyl-5-thiophen-2-ylpyrazole-3-carbonyl)pyrrolidine-3-carbonitrile (PubChem CID 146076048) has the molecular formula C19H15FN4OS and a molecular weight of 366.42 g/mol. Its IUPAC name is 3-fluoro-1-(1-phenyl-5-thiophen-2-ylpyrazole-3-carbonyl)pyrrolidine-3-carbonitrile.
| Compound Name | 3-fluoro-1-(1-phenyl-5-thiophen-2-ylpyrazole-3-carbonyl)pyrrolidine-3-carbonitrile |
|---|---|
| PubChem CID | 146076048 |
| Molecular Formula | C19H15FN4OS |
| Molecular Weight | 366.42 g/mol |
| Exact Mass | 366.10 |
| IUPAC Name | 3-fluoro-1-(1-phenyl-5-thiophen-2-ylpyrazole-3-carbonyl)pyrrolidine-3-carbonitrile |
| SMILES | N#CC1(F)CCN(C(=O)c2cc(-c3cccs3)n(-c3ccccc3)n2)C1 |
| InChI | InChI=1S/C19H15FN4OS/c20-19(12-21)8-9-23(13-19)18(25)15-11-16(17-7-4-10-26-17)24(22-15)14-5-2-1-3-6-14/h1-7,10-11H,8-9,13H2 |
| InChIKey | XQKGJXVUKGVHQX-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 61.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.42 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |