C14H24N4O3 — CID 119521079
1-[2-[4-(1-aminoethyl)piperidin-1-yl]-2-oxoethyl]-5,5-dimethylimidazolidine-2,4-dione (PubChem CID 119521079) has the molecular formula C14H24N4O3 and a molecular weight of 296.37 g/mol. Its IUPAC name is 1-[2-[4-(1-aminoethyl)piperidin-1-yl]-2-oxoethyl]-5,5-dimethylimidazolidine-2,4-dione.
| Compound Name | 1-[2-[4-(1-aminoethyl)piperidin-1-yl]-2-oxoethyl]-5,5-dimethylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 119521079 |
| Molecular Formula | C14H24N4O3 |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.18 |
| IUPAC Name | 1-[2-[4-(1-aminoethyl)piperidin-1-yl]-2-oxoethyl]-5,5-dimethylimidazolidine-2,4-dione |
| SMILES | CC(N)C1CCN(C(=O)CN2C(=O)NC(=O)C2(C)C)CC1 |
| InChI | InChI=1S/C14H24N4O3/c1-9(15)10-4-6-17(7-5-10)11(19)8-18-13(21)16-12(20)14(18,2)3/h9-10H,4-8,15H2,1-3H3,(H,16,20,21) |
| InChIKey | WYJAFRNLAOLQTE-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 95.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|