C18H21ClN4O4S — CID 119527887
N-(2-amino-2-phenylethyl)-1-(5-nitrothiophene-2-carbonyl)pyrrolidine-2-carboxamide;hydrochloride (PubChem CID 119527887) has the molecular formula C18H21ClN4O4S and a molecular weight of 424.91 g/mol. Its IUPAC name is N-(2-amino-2-phenylethyl)-1-(5-nitrothiophene-2-carbonyl)pyrrolidine-2-carboxamide;hydrochloride.
| Compound Name | N-(2-amino-2-phenylethyl)-1-(5-nitrothiophene-2-carbonyl)pyrrolidine-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119527887 |
| Molecular Formula | C18H21ClN4O4S |
| Molecular Weight | 424.91 g/mol |
| Exact Mass | 424.10 |
| IUPAC Name | N-(2-amino-2-phenylethyl)-1-(5-nitrothiophene-2-carbonyl)pyrrolidine-2-carboxamide;hydrochloride |
| SMILES | Cl.NC(CNC(=O)C1CCCN1C(=O)c1ccc([N+](=O)[O-])s1)c1ccccc1 |
| InChI | InChI=1S/C18H20N4O4S.ClH/c19-13(12-5-2-1-3-6-12)11-20-17(23)14-7-4-10-21(14)18(24)15-8-9-16(27-15)22(25)26;/h1-3,5-6,8-9,13-14H,4,7,10-11,19H2,(H,20,23);1H |
| InChIKey | PZAIJIWRMVZVIB-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 118.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.91 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|