C12H12N6O4S — CID 95765280
(2S)-1-(5-nitrothiophene-2-carbonyl)-N-(1H-1,2,4-triazol-5-yl)pyrrolidine-2-carboxamide (PubChem CID 95765280) has the molecular formula C12H12N6O4S and a molecular weight of 336.33 g/mol. Its IUPAC name is (2S)-1-(5-nitrothiophene-2-carbonyl)-N-(1H-1,2,4-triazol-5-yl)pyrrolidine-2-carboxamide.
| Compound Name | (2S)-1-(5-nitrothiophene-2-carbonyl)-N-(1H-1,2,4-triazol-5-yl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 95765280 |
| Molecular Formula | C12H12N6O4S |
| Molecular Weight | 336.33 g/mol |
| Exact Mass | 336.06 |
| IUPAC Name | (2S)-1-(5-nitrothiophene-2-carbonyl)-N-(1H-1,2,4-triazol-5-yl)pyrrolidine-2-carboxamide |
| SMILES | O=C(Nc1ncn[nH]1)[C@@H]1CCCN1C(=O)c1ccc([N+](=O)[O-])s1 |
| InChI | InChI=1S/C12H12N6O4S/c19-10(15-12-13-6-14-16-12)7-2-1-5-17(7)11(20)8-3-4-9(23-8)18(21)22/h3-4,6-7H,1-2,5H2,(H2,13,14,15,16,19)/t7-/m0/s1 |
| InChIKey | CRNAKOPZOPLBDT-ZETCQYMHSA-N |
| XLogP | 1.02 |
| TPSA | 134.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.33 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|