C16H24ClN5O4S — CID 119445780
1-(5-nitrothiophene-2-carbonyl)-N-(2-piperazin-1-ylethyl)pyrrolidine-2-carboxamide;hydrochloride (PubChem CID 119445780) has the molecular formula C16H24ClN5O4S and a molecular weight of 417.92 g/mol. Its IUPAC name is 1-(5-nitrothiophene-2-carbonyl)-N-(2-piperazin-1-ylethyl)pyrrolidine-2-carboxamide;hydrochloride.
| Compound Name | 1-(5-nitrothiophene-2-carbonyl)-N-(2-piperazin-1-ylethyl)pyrrolidine-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119445780 |
| Molecular Formula | C16H24ClN5O4S |
| Molecular Weight | 417.92 g/mol |
| Exact Mass | 417.12 |
| IUPAC Name | 1-(5-nitrothiophene-2-carbonyl)-N-(2-piperazin-1-ylethyl)pyrrolidine-2-carboxamide;hydrochloride |
| SMILES | Cl.O=C(NCCN1CCNCC1)C1CCCN1C(=O)c1ccc([N+](=O)[O-])s1 |
| InChI | InChI=1S/C16H23N5O4S.ClH/c22-15(18-7-11-19-9-5-17-6-10-19)12-2-1-8-20(12)16(23)13-3-4-14(26-13)21(24)25;/h3-4,12,17H,1-2,5-11H2,(H,18,22);1H |
| InChIKey | HSKANNUSSYGJKW-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 107.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.92 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|