C16H21ClN6O4S — CID 120956263
[2-[3-(1-methylpiperazin-2-yl)-1,2,4-oxadiazol-5-yl]pyrrolidin-1-yl]-(5-nitrothiophen-2-yl)methanone;hydrochloride (PubChem CID 120956263) has the molecular formula C16H21ClN6O4S and a molecular weight of 428.90 g/mol. Its IUPAC name is [2-[3-(1-methylpiperazin-2-yl)-1,2,4-oxadiazol-5-yl]pyrrolidin-1-yl]-(5-nitrothiophen-2-yl)methanone;hydrochloride.
| Compound Name | [2-[3-(1-methylpiperazin-2-yl)-1,2,4-oxadiazol-5-yl]pyrrolidin-1-yl]-(5-nitrothiophen-2-yl)methanone;hydrochloride |
|---|---|
| PubChem CID | 120956263 |
| Molecular Formula | C16H21ClN6O4S |
| Molecular Weight | 428.90 g/mol |
| Exact Mass | 428.10 |
| IUPAC Name | [2-[3-(1-methylpiperazin-2-yl)-1,2,4-oxadiazol-5-yl]pyrrolidin-1-yl]-(5-nitrothiophen-2-yl)methanone;hydrochloride |
| SMILES | CN1CCNCC1c1noc(C2CCCN2C(=O)c2ccc([N+](=O)[O-])s2)n1.Cl |
| InChI | InChI=1S/C16H20N6O4S.ClH/c1-20-8-6-17-9-11(20)14-18-15(26-19-14)10-3-2-7-21(10)16(23)12-4-5-13(27-12)22(24)25;/h4-5,10-11,17H,2-3,6-9H2,1H3;1H |
| InChIKey | APCQSORYUJOCKW-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 117.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.90 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|