C17H18N4O4 — CID 90564523
[2-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)pyrrolidin-1-yl]-(4-methyl-3-nitrophenyl)methanone (PubChem CID 90564523) has the molecular formula C17H18N4O4 and a molecular weight of 342.36 g/mol. Its IUPAC name is [2-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)pyrrolidin-1-yl]-(4-methyl-3-nitrophenyl)methanone.
| Compound Name | [2-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)pyrrolidin-1-yl]-(4-methyl-3-nitrophenyl)methanone |
|---|---|
| PubChem CID | 90564523 |
| Molecular Formula | C17H18N4O4 |
| Molecular Weight | 342.36 g/mol |
| Exact Mass | 342.13 |
| IUPAC Name | [2-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)pyrrolidin-1-yl]-(4-methyl-3-nitrophenyl)methanone |
| SMILES | Cc1ccc(C(=O)N2CCCC2c2nc(C3CC3)no2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H18N4O4/c1-10-4-5-12(9-14(10)21(23)24)17(22)20-8-2-3-13(20)16-18-15(19-25-16)11-6-7-11/h4-5,9,11,13H,2-3,6-8H2,1H3 |
| InChIKey | MSDWSIXOLRHZCC-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 102.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.36 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|