C18H21N5O4 — CID 120861642
[2-[3-(1-aminocyclobutyl)-1,2,4-oxadiazol-5-yl]pyrrolidin-1-yl]-(3-methyl-4-nitrophenyl)methanone (PubChem CID 120861642) has the molecular formula C18H21N5O4 and a molecular weight of 371.40 g/mol. Its IUPAC name is [2-[3-(1-aminocyclobutyl)-1,2,4-oxadiazol-5-yl]pyrrolidin-1-yl]-(3-methyl-4-nitrophenyl)methanone.
| Compound Name | [2-[3-(1-aminocyclobutyl)-1,2,4-oxadiazol-5-yl]pyrrolidin-1-yl]-(3-methyl-4-nitrophenyl)methanone |
|---|---|
| PubChem CID | 120861642 |
| Molecular Formula | C18H21N5O4 |
| Molecular Weight | 371.40 g/mol |
| Exact Mass | 371.16 |
| IUPAC Name | [2-[3-(1-aminocyclobutyl)-1,2,4-oxadiazol-5-yl]pyrrolidin-1-yl]-(3-methyl-4-nitrophenyl)methanone |
| SMILES | Cc1cc(C(=O)N2CCCC2c2nc(C3(N)CCC3)no2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H21N5O4/c1-11-10-12(5-6-13(11)23(25)26)16(24)22-9-2-4-14(22)15-20-17(21-27-15)18(19)7-3-8-18/h5-6,10,14H,2-4,7-9,19H2,1H3 |
| InChIKey | NTJRYZMAFYAEAF-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 128.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.40 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|