C18H34O4Si — CID 11953445
2-[(2R,6S)-6-(2-trimethylsilyloxyprop-2-enyl)oxan-2-yl]ethyl 2,2-dimethylpropanoate (PubChem CID 11953445) has the molecular formula C18H34O4Si and a molecular weight of 342.55 g/mol. Its IUPAC name is 2-[(2R,6S)-6-(2-trimethylsilyloxyprop-2-enyl)oxan-2-yl]ethyl 2,2-dimethylpropanoate.
| Compound Name | 2-[(2R,6S)-6-(2-trimethylsilyloxyprop-2-enyl)oxan-2-yl]ethyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 11953445 |
| Molecular Formula | C18H34O4Si |
| Molecular Weight | 342.55 g/mol |
| Exact Mass | 342.22 |
| IUPAC Name | 2-[(2R,6S)-6-(2-trimethylsilyloxyprop-2-enyl)oxan-2-yl]ethyl 2,2-dimethylpropanoate |
| SMILES | C=C(C[C@@H]1CCC[C@H](CCOC(=O)C(C)(C)C)O1)O[Si](C)(C)C |
| InChI | InChI=1S/C18H34O4Si/c1-14(22-23(5,6)7)13-16-10-8-9-15(21-16)11-12-20-17(19)18(2,3)4/h15-16H,1,8-13H2,2-7H3/t15-,16+/m1/s1 |
| InChIKey | DIBPMAKBDFPPFZ-CVEARBPZSA-N |
| XLogP | 4.66 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.55 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|