C24H48O4Si — CID 102465937
4-[tert-butyl(dimethyl)silyl]peroxytridec-1-en-6-yl 2,2-dimethylpropanoate (PubChem CID 102465937) has the molecular formula C24H48O4Si and a molecular weight of 428.73 g/mol. Its IUPAC name is 4-[tert-butyl(dimethyl)silyl]peroxytridec-1-en-6-yl 2,2-dimethylpropanoate.
| Compound Name | 4-[tert-butyl(dimethyl)silyl]peroxytridec-1-en-6-yl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 102465937 |
| Molecular Formula | C24H48O4Si |
| Molecular Weight | 428.73 g/mol |
| Exact Mass | 428.33 |
| IUPAC Name | 4-[tert-butyl(dimethyl)silyl]peroxytridec-1-en-6-yl 2,2-dimethylpropanoate |
| SMILES | C=CCC(CC(CCCCCCC)OC(=O)C(C)(C)C)OO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C24H48O4Si/c1-11-13-14-15-16-18-20(26-22(25)23(3,4)5)19-21(17-12-2)27-28-29(9,10)24(6,7)8/h12,20-21H,2,11,13-19H2,1,3-10H3 |
| InChIKey | AQHWRTRQLFVPLQ-UHFFFAOYSA-N |
| XLogP | 7.59 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.73 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|