C18H27N3O3S — CID 119540040
N-(2-methoxyethyl)-2-[2-[3-(methylaminomethyl)pyrrolidine-1-carbonyl]phenyl]sulfanylacetamide (PubChem CID 119540040) has the molecular formula C18H27N3O3S and a molecular weight of 365.50 g/mol. Its IUPAC name is N-(2-methoxyethyl)-2-[2-[3-(methylaminomethyl)pyrrolidine-1-carbonyl]phenyl]sulfanylacetamide.
| Compound Name | N-(2-methoxyethyl)-2-[2-[3-(methylaminomethyl)pyrrolidine-1-carbonyl]phenyl]sulfanylacetamide |
|---|---|
| PubChem CID | 119540040 |
| Molecular Formula | C18H27N3O3S |
| Molecular Weight | 365.50 g/mol |
| Exact Mass | 365.18 |
| IUPAC Name | N-(2-methoxyethyl)-2-[2-[3-(methylaminomethyl)pyrrolidine-1-carbonyl]phenyl]sulfanylacetamide |
| SMILES | CNCC1CCN(C(=O)c2ccccc2SCC(=O)NCCOC)C1 |
| InChI | InChI=1S/C18H27N3O3S/c1-19-11-14-7-9-21(12-14)18(23)15-5-3-4-6-16(15)25-13-17(22)20-8-10-24-2/h3-6,14,19H,7-13H2,1-2H3,(H,20,22) |
| InChIKey | PUNSNVJWYFGJPT-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.50 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|