C17H25N3O2S — CID 119549649
N-[2-(4-aminophenyl)ethyl]-2-(2-oxo-2-piperidin-1-ylethyl)sulfanylacetamide (PubChem CID 119549649) has the molecular formula C17H25N3O2S and a molecular weight of 335.47 g/mol. Its IUPAC name is N-[2-(4-aminophenyl)ethyl]-2-(2-oxo-2-piperidin-1-ylethyl)sulfanylacetamide.
| Compound Name | N-[2-(4-aminophenyl)ethyl]-2-(2-oxo-2-piperidin-1-ylethyl)sulfanylacetamide |
|---|---|
| PubChem CID | 119549649 |
| Molecular Formula | C17H25N3O2S |
| Molecular Weight | 335.47 g/mol |
| Exact Mass | 335.17 |
| IUPAC Name | N-[2-(4-aminophenyl)ethyl]-2-(2-oxo-2-piperidin-1-ylethyl)sulfanylacetamide |
| SMILES | Nc1ccc(CCNC(=O)CSCC(=O)N2CCCCC2)cc1 |
| InChI | InChI=1S/C17H25N3O2S/c18-15-6-4-14(5-7-15)8-9-19-16(21)12-23-13-17(22)20-10-2-1-3-11-20/h4-7H,1-3,8-13,18H2,(H,19,21) |
| InChIKey | TZECEZVLRIZUJX-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.47 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|