C20H22ClFN4O3 — CID 119549660
N-[2-(4-aminophenyl)ethyl]-2-[4-(4-fluorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetamide;hydrochloride (PubChem CID 119549660) has the molecular formula C20H22ClFN4O3 and a molecular weight of 420.87 g/mol. Its IUPAC name is N-[2-(4-aminophenyl)ethyl]-2-[4-(4-fluorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetamide;hydrochloride.
| Compound Name | N-[2-(4-aminophenyl)ethyl]-2-[4-(4-fluorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetamide;hydrochloride |
|---|---|
| PubChem CID | 119549660 |
| Molecular Formula | C20H22ClFN4O3 |
| Molecular Weight | 420.87 g/mol |
| Exact Mass | 420.14 |
| IUPAC Name | N-[2-(4-aminophenyl)ethyl]-2-[4-(4-fluorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetamide;hydrochloride |
| SMILES | CC1(c2ccc(F)cc2)NC(=O)N(CC(=O)NCCc2ccc(N)cc2)C1=O.Cl |
| InChI | InChI=1S/C20H21FN4O3.ClH/c1-20(14-4-6-15(21)7-5-14)18(27)25(19(28)24-20)12-17(26)23-11-10-13-2-8-16(22)9-3-13;/h2-9H,10-12,22H2,1H3,(H,23,26)(H,24,28);1H |
| InChIKey | ZIQAISXCZXNNMB-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 104.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.87 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|