C20H29FN4O3 — CID 43044795
N-[2-[di(propan-2-yl)amino]ethyl]-2-[4-(4-fluorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetamide (PubChem CID 43044795) has the molecular formula C20H29FN4O3 and a molecular weight of 392.48 g/mol. Its IUPAC name is N-[2-[di(propan-2-yl)amino]ethyl]-2-[4-(4-fluorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetamide.
| Compound Name | N-[2-[di(propan-2-yl)amino]ethyl]-2-[4-(4-fluorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetamide |
|---|---|
| PubChem CID | 43044795 |
| Molecular Formula | C20H29FN4O3 |
| Molecular Weight | 392.48 g/mol |
| Exact Mass | 392.22 |
| IUPAC Name | N-[2-[di(propan-2-yl)amino]ethyl]-2-[4-(4-fluorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetamide |
| SMILES | CC(C)N(CCNC(=O)CN1C(=O)NC(C)(c2ccc(F)cc2)C1=O)C(C)C |
| InChI | InChI=1S/C20H29FN4O3/c1-13(2)24(14(3)4)11-10-22-17(26)12-25-18(27)20(5,23-19(25)28)15-6-8-16(21)9-7-15/h6-9,13-14H,10-12H2,1-5H3,(H,22,26)(H,23,28) |
| InChIKey | DPKKADRNENNWOY-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.48 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|